ChemNet > CAS > 226396-32-3 2,3,4-Trifluorophenylboronic acid
226396-32-3 2,3,4-Trifluorophenylboronic acid
اسم المنتج |
2,3,4-Trifluorophenylboronic acid |
الصيغة الجزيئية |
C6H4BF3O2 |
الوزن الجزيئي الغرامي |
175.901 |
InChI |
InChI=1/C6H4BF3O2/c8-4-2-1-3(7(11)12)5(9)6(4)10/h1-2,11-12H |
إستراتيجية المساعدة القطرية |
226396-32-3 |
بنية جزيئية |
|
كثافة |
1.44g/cm3 |
درجة الإنصهار |
229-235℃ |
نقطة الغليان |
260.2°C at 760 mmHg |
معامل الإنكسار |
1.465 |
نقطة الوميض |
111.2°C |
علامات على البضائع الخطرة |
|
خطر المصطلحات |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
شروط الأمن |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|